Statistics for The synthesis and structural characterization of some triorganotin (IV) complexes of 2-{[(E)-1-(2-hydroxyaryl) alkylidene]amino} acetic acid. Crystal and molecular structures of Ph3Sn(2-OHC6H4C(H)=NCH2COO) and Me3Sn(2-OHC6H4C(CH3)=NCH2COO)
Total visits
| views | |
|---|---|
| The synthesis and structural characterization of some triorganotin (IV) complexes of 2-{[(E)-1-(2-hydroxyaryl) alkylidene]amino} acetic acid. Crystal and molecular structures of Ph3Sn(2-OHC6H4C(H)=NCH2COO) and Me3Sn(2-OHC6H4C(CH3)=NCH2COO) | 0 |
Total visits per month
| views | |
|---|---|
| July 2025 | 0 |
| August 2025 | 0 |
| September 2025 | 0 |
| October 2025 | 0 |
| November 2025 | 0 |
| December 2025 | 0 |
| January 2026 | 0 |