Statistics for Synthesis, spectroscopic characterization of tribenzyltin(IV) complexes of polyaromatic carboxylic acid ligands: crystal and molecular structures of Bz3Sn[O2CC6H4-{N=N(C6H3-4-Oh(C(H)=NC6H4X-4))}-0](OH2)(X=-C1, -OCH3)
Total visits
| views | |
|---|---|
| Synthesis, spectroscopic characterization of tribenzyltin(IV) complexes of polyaromatic carboxylic acid ligands: crystal and molecular structures of Bz3Sn[O2CC6H4-{N=N(C6H3-4-Oh(C(H)=NC6H4X-4))}-0](OH2)(X=-C1, -OCH3) | 0 |
Total visits per month
| views | |
|---|---|
| July 2025 | 0 |
| August 2025 | 0 |
| September 2025 | 0 |
| October 2025 | 0 |
| November 2025 | 0 |
| December 2025 | 0 |
| January 2026 | 0 |